About 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine
6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 56918236) has the molecular formula C20H32N6
and a molecular weight of 356.52 g/mol. Its IUPAC name is 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 56918236 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CC1CCCCN1CCN(C)c1nc(C2CCCC2)nc2c1cnn2C |
| InChI | InChI=1S/C20H32N6/c1-15-8-6-7-11-26(15)13-12-24(2)19-17-14-21-25(3)20(17)23-18(22-19)16-9-4-5-10-16/h14-16H,4-13H2,1-3H3 |
| InChIKey | IZBXAIFZGJPTEL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine (CID 56918236) is 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine is CC1CCCCN1CCN(C)c1nc(C2CCCC2)nc2c1cnn2C.
What is the InChIKey of 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is IZBXAIFZGJPTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N6/c1-15-8-6-7-11-26(15)13-12-24(2)19-17-14-21-25(3)20(17)23-18(22-19)16-9-4-5-10-16/h14-16H,4-13H2,1-3H3.
What are the key properties of 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine?
6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 356.52 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopentyl-N,1-dimethyl-N-[2-(2-methylpiperidin-1-yl)ethyl]pyrazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 56918236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).