About N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine
N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine (PubChem CID 56918257) has the molecular formula C13H12Cl2N4S
and a molecular weight of 327.24 g/mol. Its IUPAC name is N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine |
| PubChem CID | 56918257 |
| Molecular Formula | C13H12Cl2N4S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine |
| SMILES | CN(Cc1cccnc1Cl)Cc1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C13H12Cl2N4S/c1-18(7-9-3-2-4-16-11(9)14)8-10-12(15)17-13-19(10)5-6-20-13/h2-6H,7-8H2,1H3 |
| InChIKey | QZWUJKOKVWQRQQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine?
The IUPAC name of N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine (CID 56918257) is N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine.
What is the SMILES notation for N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine?
The canonical SMILES for N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine is CN(Cc1cccnc1Cl)Cc1c(Cl)nc2sccn12.
What is the InChIKey of N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine?
The InChIKey is QZWUJKOKVWQRQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N4S/c1-18(7-9-3-2-4-16-11(9)14)8-10-12(15)17-13-19(10)5-6-20-13/h2-6H,7-8H2,1H3.
What are the key properties of N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine?
N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine has a molecular weight of 327.24 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-1-(2-chloro-3-pyridinyl)-N-methylmethanamine is sourced from PubChem (CID 56918257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).