C26H28N2O2 — CID 56918366
[6-[4-(hydroxymethyl)phenyl]-3-pyridinyl]-[4-(2-phenylethyl)piperidin-1-yl]methanone (PubChem CID 56918366) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is [6-[4-(hydroxymethyl)phenyl]-3-pyridinyl]-[4-(2-phenylethyl)piperidin-1-yl]methanone.
| Compound Name | [6-[4-(hydroxymethyl)phenyl]-3-pyridinyl]-[4-(2-phenylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56918366 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [6-[4-(hydroxymethyl)phenyl]-3-pyridinyl]-[4-(2-phenylethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(CO)cc2)nc1)N1CCC(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N2O2/c29-19-22-8-10-23(11-9-22)25-13-12-24(18-27-25)26(30)28-16-14-21(15-17-28)7-6-20-4-2-1-3-5-20/h1-5,8-13,18,21,29H,6-7,14-17,19H2 |
| InChIKey | CWUYOZPKOCJFIS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |