C21H25NO2 — CID 56918400
1-[1-[(4-hydroxyphenyl)methyl]piperidin-3-yl]-3-phenylpropan-1-one (PubChem CID 56918400) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[1-[(4-hydroxyphenyl)methyl]piperidin-3-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[1-[(4-hydroxyphenyl)methyl]piperidin-3-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 56918400 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-[1-[(4-hydroxyphenyl)methyl]piperidin-3-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)C1CCCN(Cc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C21H25NO2/c23-20-11-8-18(9-12-20)15-22-14-4-7-19(16-22)21(24)13-10-17-5-2-1-3-6-17/h1-3,5-6,8-9,11-12,19,23H,4,7,10,13-16H2 |
| InChIKey | SOAYATPGMFHHFX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |