About 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one
1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one (PubChem CID 56918431) has the molecular formula C20H19N3O2
and a molecular weight of 333.39 g/mol. Its IUPAC name is 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one.
Molecular Properties
| Compound Name | 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one |
| PubChem CID | 56918431 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one |
| SMILES | CN1C(=O)C2(CCN(c3nccc4occc34)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H19N3O2/c1-22-16-5-3-2-4-15(16)20(19(22)24)8-11-23(12-9-20)18-14-7-13-25-17(14)6-10-21-18/h2-7,10,13H,8-9,11-12H2,1H3 |
| InChIKey | YSZMJBVMIHXARM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one?
The IUPAC name of 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one (CID 56918431) is 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one.
What is the SMILES notation for 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one?
The canonical SMILES for 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one is CN1C(=O)C2(CCN(c3nccc4occc34)CC2)c2ccccc21.
What is the InChIKey of 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one?
The InChIKey is YSZMJBVMIHXARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2/c1-22-16-5-3-2-4-15(16)20(19(22)24)8-11-23(12-9-20)18-14-7-13-25-17(14)6-10-21-18/h2-7,10,13H,8-9,11-12H2,1H3.
What are the key properties of 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one?
1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one has a molecular weight of 333.39 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-furo[3,2-c]pyridin-4-yl-1-methylspiro[indole-3,4'-piperidine]-2-one is sourced from PubChem (CID 56918431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).