C15H19N5O3 — CID 56918673
1-(3-methoxypyrazin-2-yl)-4-(4-methylpyrazol-1-yl)piperidine-4-carboxylic acid (PubChem CID 56918673) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 1-(3-methoxypyrazin-2-yl)-4-(4-methylpyrazol-1-yl)piperidine-4-carboxylic acid.
| Compound Name | 1-(3-methoxypyrazin-2-yl)-4-(4-methylpyrazol-1-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56918673 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-(3-methoxypyrazin-2-yl)-4-(4-methylpyrazol-1-yl)piperidine-4-carboxylic acid |
| SMILES | COc1nccnc1N1CCC(C(=O)O)(n2cc(C)cn2)CC1 |
| InChI | InChI=1S/C15H19N5O3/c1-11-9-18-20(10-11)15(14(21)22)3-7-19(8-4-15)12-13(23-2)17-6-5-16-12/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,21,22) |
| InChIKey | GTMDOCOPOUODIS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |