C21H24N2O3 — CID 56918819
[(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-4-phenyl-3-pyridinyl)methanone (PubChem CID 56918819) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-4-phenyl-3-pyridinyl)methanone.
| Compound Name | [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-4-phenyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 56918819 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [(3aS,5S,6R,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-4-phenyl-3-pyridinyl)methanone |
| SMILES | Cc1nccc(-c2ccccc2)c1C(=O)N1C[C@H]2C[C@H](O)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C21H24N2O3/c1-13-20(17(7-8-22-13)14-5-3-2-4-6-14)21(26)23-11-15-9-18(24)19(25)10-16(15)12-23/h2-8,15-16,18-19,24-25H,9-12H2,1H3/t15-,16+,18+,19- |
| InChIKey | HUXMIWAJZHNJQA-XHVUQVIVSA-N |
| XLogP | 2.26 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |