About [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol
[2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol (PubChem CID 56919025) has the molecular formula C14H13F3N2O
and a molecular weight of 282.26 g/mol. Its IUPAC name is [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol |
| PubChem CID | 56919025 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol |
| SMILES | OCc1ccccc1-c1nccc(CCC(F)(F)F)n1 |
| InChI | InChI=1S/C14H13F3N2O/c15-14(16,17)7-5-11-6-8-18-13(19-11)12-4-2-1-3-10(12)9-20/h1-4,6,8,20H,5,7,9H2 |
| InChIKey | KVSHDAGDHWMPIQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol?
The IUPAC name of [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol (CID 56919025) is [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol.
What is the SMILES notation for [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol?
The canonical SMILES for [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol is OCc1ccccc1-c1nccc(CCC(F)(F)F)n1.
What is the InChIKey of [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol?
The InChIKey is KVSHDAGDHWMPIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N2O/c15-14(16,17)7-5-11-6-8-18-13(19-11)12-4-2-1-3-10(12)9-20/h1-4,6,8,20H,5,7,9H2.
What are the key properties of [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol?
[2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol has a molecular weight of 282.26 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]phenyl]methanol is sourced from PubChem (CID 56919025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).