C15H19N7O — CID 56920499
N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazine-2-carboxamide (PubChem CID 56920499) has the molecular formula C15H19N7O and a molecular weight of 313.37 g/mol. Its IUPAC name is N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 56920499 |
| Molecular Formula | C15H19N7O |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCNc1cc(N2CCCC2)ncn1)c1cnccn1 |
| InChI | InChI=1S/C15H19N7O/c23-15(12-10-16-3-4-17-12)19-6-5-18-13-9-14(21-11-20-13)22-7-1-2-8-22/h3-4,9-11H,1-2,5-8H2,(H,19,23)(H,18,20,21) |
| InChIKey | UORNTMIAOZJOMZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|