C20H25FN6O2 — CID 56920620
N-(3-fluoro-2-methylphenyl)-4-(6-morpholin-4-ylpyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 56920620) has the molecular formula C20H25FN6O2 and a molecular weight of 400.46 g/mol. Its IUPAC name is N-(3-fluoro-2-methylphenyl)-4-(6-morpholin-4-ylpyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-(3-fluoro-2-methylphenyl)-4-(6-morpholin-4-ylpyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56920620 |
| Molecular Formula | C20H25FN6O2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-(3-fluoro-2-methylphenyl)-4-(6-morpholin-4-ylpyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | Cc1c(F)cccc1NC(=O)N1CCN(c2cc(N3CCOCC3)ncn2)CC1 |
| InChI | InChI=1S/C20H25FN6O2/c1-15-16(21)3-2-4-17(15)24-20(28)27-7-5-25(6-8-27)18-13-19(23-14-22-18)26-9-11-29-12-10-26/h2-4,13-14H,5-12H2,1H3,(H,24,28) |
| InChIKey | VMKSOHWIFATKMH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |