C15H12N6O2S — CID 56922254
11-(2-methoxyphenyl)-4-methylsulfanyl-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 56922254) has the molecular formula C15H12N6O2S and a molecular weight of 340.37 g/mol. Its IUPAC name is 11-(2-methoxyphenyl)-4-methylsulfanyl-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(2-methoxyphenyl)-4-methylsulfanyl-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 56922254 |
| Molecular Formula | C15H12N6O2S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 11-(2-methoxyphenyl)-4-methylsulfanyl-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COc1ccccc1-n1ccc2c(nnc3nc(SC)nn32)c1=O |
| InChI | InChI=1S/C15H12N6O2S/c1-23-11-6-4-3-5-9(11)20-8-7-10-12(13(20)22)17-18-14-16-15(24-2)19-21(10)14/h3-8H,1-2H3 |
| InChIKey | IXDMVBZVIGYZGM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |