C18H16ClNO3S — CID 56923475
4-chloro-3-(3,4-dimethylphenyl)sulfonyl-6-methoxyquinoline (PubChem CID 56923475) has the molecular formula C18H16ClNO3S and a molecular weight of 361.85 g/mol. Its IUPAC name is 4-chloro-3-(3,4-dimethylphenyl)sulfonyl-6-methoxyquinoline.
| Compound Name | 4-chloro-3-(3,4-dimethylphenyl)sulfonyl-6-methoxyquinoline |
|---|---|
| PubChem CID | 56923475 |
| Molecular Formula | C18H16ClNO3S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 4-chloro-3-(3,4-dimethylphenyl)sulfonyl-6-methoxyquinoline |
| SMILES | COc1ccc2ncc(S(=O)(=O)c3ccc(C)c(C)c3)c(Cl)c2c1 |
| InChI | InChI=1S/C18H16ClNO3S/c1-11-4-6-14(8-12(11)2)24(21,22)17-10-20-16-7-5-13(23-3)9-15(16)18(17)19/h4-10H,1-3H3 |
| InChIKey | QFDAHOIAYMHNKN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |