C11H21N2O2- — CID 56924039
N-(2,2-dimethylpropyl)-N-[(3R)-piperidin-3-yl]carbamate (PubChem CID 56924039) has the molecular formula C11H21N2O2- and a molecular weight of 213.30 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N-[(3R)-piperidin-3-yl]carbamate.
| Compound Name | N-(2,2-dimethylpropyl)-N-[(3R)-piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 56924039 |
| Molecular Formula | C11H21N2O2- |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N-[(3R)-piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)CN(C(=O)[O-])[C@@H]1CCCNC1 |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)8-13(10(14)15)9-5-4-6-12-7-9/h9,12H,4-8H2,1-3H3,(H,14,15)/p-1/t9-/m1/s1 |
| InChIKey | RAAHAZKMOOUJQT-SECBINFHSA-M |
| XLogP | 0.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |