About 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate
3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 56924060) has the molecular formula C10H8BrN2O2-
and a molecular weight of 268.09 g/mol. Its IUPAC name is 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate |
| PubChem CID | 56924060 |
| Molecular Formula | C10H8BrN2O2- |
| Molecular Weight | 268.09 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCc1cccc2nc(C(=O)[O-])c(Br)n12 |
| InChI | InChI=1S/C10H9BrN2O2/c1-2-6-4-3-5-7-12-8(10(14)15)9(11)13(6)7/h3-5H,2H2,1H3,(H,14,15)/p-1 |
| InChIKey | CQBFEKHJEJNIFD-UHFFFAOYSA-M |
| XLogP | 1.02 |
| TPSA | 57.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.09 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate?
The IUPAC name of 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate (CID 56924060) is 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate.
What is the SMILES notation for 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate?
The canonical SMILES for 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate is CCc1cccc2nc(C(=O)[O-])c(Br)n12.
What is the InChIKey of 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate?
The InChIKey is CQBFEKHJEJNIFD-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9BrN2O2/c1-2-6-4-3-5-7-12-8(10(14)15)9(11)13(6)7/h3-5H,2H2,1H3,(H,14,15)/p-1.
What are the key properties of 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate?
3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate has a molecular weight of 268.09 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-ethylimidazo[1,2-a]pyridine-2-carboxylate is sourced from PubChem (CID 56924060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).