About [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine
[(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine (PubChem CID 56924128) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine |
| PubChem CID | 56924128 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine |
| SMILES | C[C@]1(CN)C=CC=CC1 |
| InChI | InChI=1S/C8H13N/c1-8(7-9)5-3-2-4-6-8/h2-5H,6-7,9H2,1H3/t8-/m0/s1 |
| InChIKey | HYSOPXHRAHXSFM-QMMMGPOBSA-N |
| XLogP | 1.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine?
The IUPAC name of [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine (CID 56924128) is [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine.
What is the SMILES notation for [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine?
The canonical SMILES for [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine is C[C@]1(CN)C=CC=CC1.
What is the InChIKey of [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine?
The InChIKey is HYSOPXHRAHXSFM-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H13N/c1-8(7-9)5-3-2-4-6-8/h2-5H,6-7,9H2,1H3/t8-/m0/s1.
What are the key properties of [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine?
[(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine has a molecular weight of 123.20 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-methylcyclohexa-2,4-dien-1-yl]methanamine is sourced from PubChem (CID 56924128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).