About 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate
5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate (PubChem CID 56924170) has the molecular formula C9H12NO3-
and a molecular weight of 182.20 g/mol. Its IUPAC name is 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate |
| PubChem CID | 56924170 |
| Molecular Formula | C9H12NO3- |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate |
| SMILES | Cc1c(C(=O)[O-])noc1C(C)(C)C |
| InChI | InChI=1S/C9H13NO3/c1-5-6(8(11)12)10-13-7(5)9(2,3)4/h1-4H3,(H,11,12)/p-1 |
| InChIKey | RMVVSRPGUCZBTG-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate?
The IUPAC name of 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate (CID 56924170) is 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate.
What is the SMILES notation for 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate?
The canonical SMILES for 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate is Cc1c(C(=O)[O-])noc1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate?
The InChIKey is RMVVSRPGUCZBTG-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13NO3/c1-5-6(8(11)12)10-13-7(5)9(2,3)4/h1-4H3,(H,11,12)/p-1.
What are the key properties of 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate?
5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate has a molecular weight of 182.20 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-4-methyl-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 56924170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).