About N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride
N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride (PubChem CID 56924271) has the molecular formula C11H16Cl2N4O2
and a molecular weight of 307.18 g/mol. Its IUPAC name is N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride |
| PubChem CID | 56924271 |
| Molecular Formula | C11H16Cl2N4O2 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride |
| SMILES | CNC1CN(c2nc3ncccc3o2)CCO1.Cl.Cl |
| InChI | InChI=1S/C11H14N4O2.2ClH/c1-12-9-7-15(5-6-16-9)11-14-10-8(17-11)3-2-4-13-10;;/h2-4,9,12H,5-7H2,1H3;2*1H |
| InChIKey | ZLXPKLATIBMYSI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride?
The IUPAC name of N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride (CID 56924271) is N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride.
What is the SMILES notation for N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride?
The canonical SMILES for N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride is CNC1CN(c2nc3ncccc3o2)CCO1.Cl.Cl.
What is the InChIKey of N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride?
The InChIKey is ZLXPKLATIBMYSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2.2ClH/c1-12-9-7-15(5-6-16-9)11-14-10-8(17-11)3-2-4-13-10;;/h2-4,9,12H,5-7H2,1H3;2*1H.
What are the key properties of N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride?
N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride has a molecular weight of 307.18 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-([1,3]oxazolo[4,5-b]pyridin-2-yl)morpholin-2-amine;dihydrochloride is sourced from PubChem (CID 56924271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).