About CID 56924387
CID 56924387 (PubChem CID 56924387) has the molecular formula C4H7Cl3Si
and a molecular weight of 189.54 g/mol.
Molecular Properties
| Compound Name | CID 56924387 |
| PubChem CID | 56924387 |
| Molecular Formula | C4H7Cl3Si |
| Molecular Weight | 189.54 g/mol |
| Exact Mass | 187.94 |
| IUPAC Name | — |
| SMILES | ClCCC[Si]C(Cl)Cl |
| InChI | InChI=1S/C4H7Cl3Si/c5-2-1-3-8-4(6)7/h4H,1-3H2 |
| InChIKey | HCOOIMXJFWSOBN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 56924387 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56924387?
The IUPAC name of CID 56924387 (CID 56924387) is not available.
What is the SMILES notation for CID 56924387?
The canonical SMILES for CID 56924387 is ClCCC[Si]C(Cl)Cl.
What is the InChIKey of CID 56924387?
The InChIKey is HCOOIMXJFWSOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7Cl3Si/c5-2-1-3-8-4(6)7/h4H,1-3H2.
What are the key properties of CID 56924387?
CID 56924387 has a molecular weight of 189.54 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56924387 is sourced from PubChem (CID 56924387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).