C13H12O3S — CID 56924418
5-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 56924418) has the molecular formula C13H12O3S and a molecular weight of 248.30 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 56924418 |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | COc1ccc(-c2scc3c2OCCO3)cc1 |
| InChI | InChI=1S/C13H12O3S/c1-14-10-4-2-9(3-5-10)13-12-11(8-17-13)15-6-7-16-12/h2-5,8H,6-7H2,1H3 |
| InChIKey | XUQGMFYCGYHWKU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |