About (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one
(2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 56924460) has the molecular formula C13H15N3O5S
and a molecular weight of 325.35 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one |
| PubChem CID | 56924460 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | N[C@@H](CC(=O)O)C(=O)O.O=C1CN(c2ccccc2)C(=S)N1 |
| InChI | InChI=1S/C9H8N2OS.C4H7NO4/c12-8-6-11(9(13)10-8)7-4-2-1-3-5-7;5-2(4(8)9)1-3(6)7/h1-5H,6H2,(H,10,12,13);2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | JHSKEQCVFYFWAV-WNQIDUERSA-N |
| XLogP | -0.22 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one?
The IUPAC name of (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one (CID 56924460) is (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one.
What is the SMILES notation for (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one?
The canonical SMILES for (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one is N[C@@H](CC(=O)O)C(=O)O.O=C1CN(c2ccccc2)C(=S)N1.
What is the InChIKey of (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one?
The InChIKey is JHSKEQCVFYFWAV-WNQIDUERSA-N. The full InChI is InChI=1S/C9H8N2OS.C4H7NO4/c12-8-6-11(9(13)10-8)7-4-2-1-3-5-7;5-2(4(8)9)1-3(6)7/h1-5H,6H2,(H,10,12,13);2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1.
What are the key properties of (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one?
(2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one has a molecular weight of 325.35 g/mol, XLogP of -0.22, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminobutanedioic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one is sourced from PubChem (CID 56924460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).