About Sodium 2-Thiobarbiturate
Sodium 2-Thiobarbiturate (PubChem CID 56924476) has the molecular formula C4H4N2NaO2S
and a molecular weight of 167.14 g/mol.
Molecular Properties
| Compound Name | Sodium 2-Thiobarbiturate |
| PubChem CID | 56924476 |
| Molecular Formula | C4H4N2NaO2S |
| Molecular Weight | 167.14 g/mol |
| Exact Mass | 166.99 |
| IUPAC Name | — |
| SMILES | O=C1CC(=O)NC(=S)N1.[Na] |
| InChI | InChI=1S/C4H4N2O2S.Na/c7-2-1-3(8)6-4(9)5-2;/h1H2,(H2,5,6,7,8,9); |
| InChIKey | LHWPSDLHLAAELL-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.14 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze Sodium 2-Thiobarbiturate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sodium 2-Thiobarbiturate?
The IUPAC name of Sodium 2-Thiobarbiturate (CID 56924476) is not available.
What is the SMILES notation for Sodium 2-Thiobarbiturate?
The canonical SMILES for Sodium 2-Thiobarbiturate is O=C1CC(=O)NC(=S)N1.[Na].
What is the InChIKey of Sodium 2-Thiobarbiturate?
The InChIKey is LHWPSDLHLAAELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S.Na/c7-2-1-3(8)6-4(9)5-2;/h1H2,(H2,5,6,7,8,9);.
What are the key properties of Sodium 2-Thiobarbiturate?
Sodium 2-Thiobarbiturate has a molecular weight of 167.14 g/mol, XLogP of -1.47, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Sodium 2-Thiobarbiturate is sourced from PubChem (CID 56924476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).