About 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione
6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione (PubChem CID 56924725) has the molecular formula C20H19N5O2
and a molecular weight of 361.41 g/mol. Its IUPAC name is 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione |
| PubChem CID | 56924725 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)cc(Cn2c(=O)cc(N=[N+]=[N-])n(Cc3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C20H19N5O2/c1-14-8-15(2)10-17(9-14)13-25-19(26)11-18(22-23-21)24(20(25)27)12-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | PSKIVMRAJOBOST-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione?
The IUPAC name of 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione (CID 56924725) is 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione.
What is the SMILES notation for 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione?
The canonical SMILES for 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione is Cc1cc(C)cc(Cn2c(=O)cc(N=[N+]=[N-])n(Cc3ccccc3)c2=O)c1.
What is the InChIKey of 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione?
The InChIKey is PSKIVMRAJOBOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5O2/c1-14-8-15(2)10-17(9-14)13-25-19(26)11-18(22-23-21)24(20(25)27)12-16-6-4-3-5-7-16/h3-11H,12-13H2,1-2H3.
What are the key properties of 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione?
6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione has a molecular weight of 361.41 g/mol, XLogP of 3.67, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azido-1-benzyl-3-[(3,5-dimethylphenyl)methyl]pyrimidine-2,4-dione is sourced from PubChem (CID 56924725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).