C26H30N2O4 — CID 56924733
4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(8-oxo-6,7-dihydro-5H-naphthalen-1-yl)cyclohexane-1-carboxamide (PubChem CID 56924733) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(8-oxo-6,7-dihydro-5H-naphthalen-1-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(8-oxo-6,7-dihydro-5H-naphthalen-1-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 56924733 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(8-oxo-6,7-dihydro-5H-naphthalen-1-yl)cyclohexane-1-carboxamide |
| SMILES | O=C1CCCc2cccc(NC(=O)C3CCC(N4C(=O)[C@@H]5[C@@H]6CC[C@@H](C6)[C@@H]5C4=O)CC3)c21 |
| InChI | InChI=1S/C26H30N2O4/c29-20-6-2-4-14-3-1-5-19(21(14)20)27-24(30)15-9-11-18(12-10-15)28-25(31)22-16-7-8-17(13-16)23(22)26(28)32/h1,3,5,15-18,22-23H,2,4,6-13H2,(H,27,30)/t15?,16-,17+,18?,22-,23+ |
| InChIKey | STZHJWWJMHAPHU-XOSIIVGXSA-N |
| XLogP | 3.73 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|