C16H14Cl2O5 — CID 56924745
(2S,5'R)-3',7-dichloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 56924745) has the molecular formula C16H14Cl2O5 and a molecular weight of 357.19 g/mol. Its IUPAC name is (2S,5'R)-3',7-dichloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (2S,5'R)-3',7-dichloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 56924745 |
| Molecular Formula | C16H14Cl2O5 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (2S,5'R)-3',7-dichloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | COc1cc(OC)c2c(c1Cl)O[C@@]1(C(=O)C=C(Cl)C[C@H]1C)C2=O |
| InChI | InChI=1S/C16H14Cl2O5/c1-7-4-8(17)5-11(19)16(7)15(20)12-9(21-2)6-10(22-3)13(18)14(12)23-16/h5-7H,4H2,1-3H3/t7-,16+/m1/s1 |
| InChIKey | DWFAJTZKBVTMQY-QZTNRIJFSA-N |
| XLogP | 3.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|