C41H44ClN2O3+ — CID 56925215
6-[(2Z)-2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoic acid (PubChem CID 56925215) has the molecular formula C41H44ClN2O3+ and a molecular weight of 648.27 g/mol. Its IUPAC name is 6-[(2Z)-2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoic acid.
| Compound Name | 6-[(2Z)-2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 56925215 |
| Molecular Formula | C41H44ClN2O3+ |
| Molecular Weight | 648.27 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | 6-[(2Z)-2-[(2E)-2-[2-chloro-3-[(E)-2-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-1,1-dimethylbenzo[e]indol-3-yl]hexanoic acid |
| SMILES | CC1(C)/C(=C/C=C2\CCCC(/C=C/c3cc[n+](CCO)c4ccccc34)=C2Cl)N(CCCCCC(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C41H43ClN2O3/c1-41(2)37(44(25-9-3-4-17-38(46)47)36-22-20-29-11-5-6-15-34(29)39(36)41)23-21-32-13-10-12-31(40(32)42)19-18-30-24-26-43(27-28-45)35-16-8-7-14-33(30)35/h5-8,11,14-16,18-24,26,45H,3-4,9-10,12-13,17,25,27-28H2,1-2H3/p+1 |
| InChIKey | UJKOQIOKIKRTPY-UHFFFAOYSA-O |
| XLogP | 9.22 |
| TPSA | 64.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.27 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|