C17H18O5 — CID 56925398
(2R,3S,3aS,5S,6aR)-2-methyl-3-phenylmethoxyspiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,5'-furan]-2'-one (PubChem CID 56925398) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R,3S,3aS,5S,6aR)-2-methyl-3-phenylmethoxyspiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,5'-furan]-2'-one.
| Compound Name | (2R,3S,3aS,5S,6aR)-2-methyl-3-phenylmethoxyspiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,5'-furan]-2'-one |
|---|---|
| PubChem CID | 56925398 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2R,3S,3aS,5S,6aR)-2-methyl-3-phenylmethoxyspiro[3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5,5'-furan]-2'-one |
| SMILES | C[C@H]1O[C@@H]2C[C@]3(C=CC(=O)O3)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H18O5/c1-11-15(19-10-12-5-3-2-4-6-12)16-13(20-11)9-17(22-16)8-7-14(18)21-17/h2-8,11,13,15-16H,9-10H2,1H3/t11-,13-,15+,16+,17+/m1/s1 |
| InChIKey | IRNABUWNTZZGHZ-KZTGHSNKSA-N |
| XLogP | 1.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |