C22H28O8 — CID 56925421
methyl (2Z)-2-(4-methoxyphenyl)-2-[(1R,2S,6S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-ylidene]acetate (PubChem CID 56925421) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is methyl (2Z)-2-(4-methoxyphenyl)-2-[(1R,2S,6S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-ylidene]acetate.
| Compound Name | methyl (2Z)-2-(4-methoxyphenyl)-2-[(1R,2S,6S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-ylidene]acetate |
|---|---|
| PubChem CID | 56925421 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl (2Z)-2-(4-methoxyphenyl)-2-[(1R,2S,6S,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-ylidene]acetate |
| SMILES | COC(=O)/C(=C1\O[C@@H]2COC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@H]12)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H28O8/c1-21(2)26-11-14-16(28-21)18-19(30-22(3,4)29-18)17(27-14)15(20(23)25-6)12-7-9-13(24-5)10-8-12/h7-10,14,16,18-19H,11H2,1-6H3/b17-15-/t14-,16-,18+,19-/m1/s1 |
| InChIKey | WHBPBXSKNPKYPE-SEWWWZKDSA-N |
| XLogP | 2.65 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|