C15H28O3Si — CID 56925503
[(3R)-5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl] but-3-enoate (PubChem CID 56925503) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is [(3R)-5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl] but-3-enoate.
| Compound Name | [(3R)-5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl] but-3-enoate |
|---|---|
| PubChem CID | 56925503 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | [(3R)-5-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-yl] but-3-enoate |
| SMILES | C=CCC(=O)O[C@@H](C=C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O3Si/c1-8-10-14(16)18-13(9-2)11-12-17-19(6,7)15(3,4)5/h8-9,13H,1-2,10-12H2,3-7H3/t13-/m0/s1 |
| InChIKey | IQVLPDZBDBKIAH-ZDUSSCGKSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|