C21H23NO3 — CID 56925629
3-ethyl-2,6-dimethyl-7-(2-phenoxyethoxy)-1H-quinolin-4-one (PubChem CID 56925629) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-ethyl-2,6-dimethyl-7-(2-phenoxyethoxy)-1H-quinolin-4-one.
| Compound Name | 3-ethyl-2,6-dimethyl-7-(2-phenoxyethoxy)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 56925629 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 3-ethyl-2,6-dimethyl-7-(2-phenoxyethoxy)-1H-quinolin-4-one |
| SMILES | CCc1c(C)[nH]c2cc(OCCOc3ccccc3)c(C)cc2c1=O |
| InChI | InChI=1S/C21H23NO3/c1-4-17-15(3)22-19-13-20(14(2)12-18(19)21(17)23)25-11-10-24-16-8-6-5-7-9-16/h5-9,12-13H,4,10-11H2,1-3H3,(H,22,23) |
| InChIKey | JXWBDCIRVLFFNT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|