About methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate
methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate (PubChem CID 56925655) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate.
Molecular Properties
| Compound Name | methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate |
| PubChem CID | 56925655 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate |
| SMILES | CCCC[C@@]1(OC)OOC(C)(C)C[C@@H]1C(=O)OC |
| InChI | InChI=1S/C13H24O5/c1-6-7-8-13(16-5)10(11(14)15-4)9-12(2,3)17-18-13/h10H,6-9H2,1-5H3/t10-,13-/m1/s1 |
| InChIKey | POWIRKQGTNVPJG-ZWNOBZJWSA-N |
| XLogP | 2.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate?
The IUPAC name of methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate (CID 56925655) is methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate.
What is the SMILES notation for methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate?
The canonical SMILES for methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate is CCCC[C@@]1(OC)OOC(C)(C)C[C@@H]1C(=O)OC.
What is the InChIKey of methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate?
The InChIKey is POWIRKQGTNVPJG-ZWNOBZJWSA-N. The full InChI is InChI=1S/C13H24O5/c1-6-7-8-13(16-5)10(11(14)15-4)9-12(2,3)17-18-13/h10H,6-9H2,1-5H3/t10-,13-/m1/s1.
What are the key properties of methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate?
methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate has a molecular weight of 260.33 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,4S)-3-butyl-3-methoxy-6,6-dimethyldioxane-4-carboxylate is sourced from PubChem (CID 56925655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).