C13H24O5 — CID 56925657
methyl (3R,4S,6R)-6-butyl-3-methoxy-3,6-dimethyldioxane-4-carboxylate (PubChem CID 56925657) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is methyl (3R,4S,6R)-6-butyl-3-methoxy-3,6-dimethyldioxane-4-carboxylate.
| Compound Name | methyl (3R,4S,6R)-6-butyl-3-methoxy-3,6-dimethyldioxane-4-carboxylate |
|---|---|
| PubChem CID | 56925657 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | methyl (3R,4S,6R)-6-butyl-3-methoxy-3,6-dimethyldioxane-4-carboxylate |
| SMILES | CCCC[C@]1(C)C[C@H](C(=O)OC)[C@](C)(OC)OO1 |
| InChI | InChI=1S/C13H24O5/c1-6-7-8-12(2)9-10(11(14)15-4)13(3,16-5)18-17-12/h10H,6-9H2,1-5H3/t10-,12-,13-/m1/s1 |
| InChIKey | CZRSJVVFCOKIPG-RAIGVLPGSA-N |
| XLogP | 2.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|