About N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline
N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline (PubChem CID 56925767) has the molecular formula C20H23NO
and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline |
| PubChem CID | 56925767 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline |
| SMILES | Cc1ccc(NCc2ccc3c(c2)C=CC(C)(C)O3)c(C)c1 |
| InChI | InChI=1S/C20H23NO/c1-14-5-7-18(15(2)11-14)21-13-16-6-8-19-17(12-16)9-10-20(3,4)22-19/h5-12,21H,13H2,1-4H3 |
| InChIKey | MSDMWJXAZFIVSX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline?
The IUPAC name of N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline (CID 56925767) is N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline.
What is the SMILES notation for N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline?
The canonical SMILES for N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline is Cc1ccc(NCc2ccc3c(c2)C=CC(C)(C)O3)c(C)c1.
What is the InChIKey of N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline?
The InChIKey is MSDMWJXAZFIVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO/c1-14-5-7-18(15(2)11-14)21-13-16-6-8-19-17(12-16)9-10-20(3,4)22-19/h5-12,21H,13H2,1-4H3.
What are the key properties of N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline?
N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline has a molecular weight of 293.41 g/mol, XLogP of 5.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,2-dimethylchromen-6-yl)methyl]-2,4-dimethylaniline is sourced from PubChem (CID 56925767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).