C19H11F6N3O2 — CID 56925794
6-[1-(4-fluorophenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 56925794) has the molecular formula C19H11F6N3O2 and a molecular weight of 427.30 g/mol. Its IUPAC name is 6-[1-(4-fluorophenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-(4-fluorophenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 56925794 |
| Molecular Formula | C19H11F6N3O2 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 6-[1-(4-fluorophenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3cc(C(F)(F)C(F)(F)F)nn3-c3ccc(F)cc3)cc2N1 |
| InChI | InChI=1S/C19H11F6N3O2/c20-11-2-4-12(5-3-11)28-14(8-16(27-28)18(21,22)19(23,24)25)10-1-6-15-13(7-10)26-17(29)9-30-15/h1-8H,9H2,(H,26,29) |
| InChIKey | INCSCPIHTYHLON-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|