C24H34O6 — CID 56925801
(1S,2E,7R,10Z,12E,15S,16E,18Z,21S,23R,25R)-15,21,25-trihydroxy-7-methyl-8,24-dioxabicyclo[21.1.1]pentacosa-2,10,12,16,18-pentaen-9-one (PubChem CID 56925801) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (1S,2E,7R,10Z,12E,15S,16E,18Z,21S,23R,25R)-15,21,25-trihydroxy-7-methyl-8,24-dioxabicyclo[21.1.1]pentacosa-2,10,12,16,18-pentaen-9-one.
| Compound Name | (1S,2E,7R,10Z,12E,15S,16E,18Z,21S,23R,25R)-15,21,25-trihydroxy-7-methyl-8,24-dioxabicyclo[21.1.1]pentacosa-2,10,12,16,18-pentaen-9-one |
|---|---|
| PubChem CID | 56925801 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (1S,2E,7R,10Z,12E,15S,16E,18Z,21S,23R,25R)-15,21,25-trihydroxy-7-methyl-8,24-dioxabicyclo[21.1.1]pentacosa-2,10,12,16,18-pentaen-9-one |
| SMILES | C[C@@H]1CCC/C=C\[C@@H]2O[C@H](C[C@@H](O)C/C=C\C=C\[C@@H](O)C/C=C/C=C\C(=O)O1)[C@H]2O |
| InChI | InChI=1S/C24H34O6/c1-18-11-5-2-9-15-21-24(28)22(30-21)17-20(26)14-8-3-6-12-19(25)13-7-4-10-16-23(27)29-18/h3-4,6-10,12,15-16,18-22,24-26,28H,2,5,11,13-14,17H2,1H3/b7-4+,8-3-,12-6+,15-9-,16-10-/t18-,19-,20+,21+,22-,24+/m1/s1 |
| InChIKey | YWWAYEWLZVNRNN-YLEDRKGWSA-N |
| XLogP | 2.90 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|