About 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione
1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione (PubChem CID 56925898) has the molecular formula C18H13Cl3N2O4
and a molecular weight of 427.67 g/mol. Its IUPAC name is 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione |
| PubChem CID | 56925898 |
| Molecular Formula | C18H13Cl3N2O4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CCOc2cc(Cl)cc(Cl)c2Oc2ccccc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C18H13Cl3N2O4/c19-11-9-13(21)17(27-14-4-2-1-3-12(14)20)15(10-11)26-8-7-23-6-5-16(24)22-18(23)25/h1-6,9-10H,7-8H2,(H,22,24,25) |
| InChIKey | IVJBKRFWINFJSY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione?
The IUPAC name of 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione (CID 56925898) is 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione.
What is the SMILES notation for 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione?
The canonical SMILES for 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione is O=c1ccn(CCOc2cc(Cl)cc(Cl)c2Oc2ccccc2Cl)c(=O)[nH]1.
What is the InChIKey of 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione?
The InChIKey is IVJBKRFWINFJSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl3N2O4/c19-11-9-13(21)17(27-14-4-2-1-3-12(14)20)15(10-11)26-8-7-23-6-5-16(24)22-18(23)25/h1-6,9-10H,7-8H2,(H,22,24,25).
What are the key properties of 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione?
1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione has a molecular weight of 427.67 g/mol, XLogP of 4.37, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[3,5-dichloro-2-(2-chlorophenoxy)phenoxy]ethyl]pyrimidine-2,4-dione is sourced from PubChem (CID 56925898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).