C24H34N2O3 — CID 56925982
5-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 56925982) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 5-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 56925982 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 5-[6-[ethyl-[(2-methoxyphenyl)methyl]amino]hexylamino]-2,3-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCCCCCNC1=CC(=O)C(C)=C(C)C1=O)Cc1ccccc1OC |
| InChI | InChI=1S/C24H34N2O3/c1-5-26(17-20-12-8-9-13-23(20)29-4)15-11-7-6-10-14-25-21-16-22(27)18(2)19(3)24(21)28/h8-9,12-13,16,25H,5-7,10-11,14-15,17H2,1-4H3 |
| InChIKey | ASNWOHSUKKNPGO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|