About N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine
N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine (PubChem CID 56926046) has the molecular formula C13H26N2O7P2
and a molecular weight of 384.31 g/mol. Its IUPAC name is N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine |
| PubChem CID | 56926046 |
| Molecular Formula | C13H26N2O7P2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine |
| SMILES | CCOP(=O)(OCC)C(Nc1cnc(C)o1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H26N2O7P2/c1-6-18-23(16,19-7-2)13(15-12-10-14-11(5)22-12)24(17,20-8-3)21-9-4/h10,13,15H,6-9H2,1-5H3 |
| InChIKey | LUSQYYKPYBITLY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine?
The IUPAC name of N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine (CID 56926046) is N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine.
What is the SMILES notation for N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine?
The canonical SMILES for N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine is CCOP(=O)(OCC)C(Nc1cnc(C)o1)P(=O)(OCC)OCC.
What is the InChIKey of N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine?
The InChIKey is LUSQYYKPYBITLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O7P2/c1-6-18-23(16,19-7-2)13(15-12-10-14-11(5)22-12)24(17,20-8-3)21-9-4/h10,13,15H,6-9H2,1-5H3.
What are the key properties of N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine?
N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine has a molecular weight of 384.31 g/mol, XLogP of 4.21, 12 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(diethoxyphosphoryl)methyl]-2-methyl-1,3-oxazol-5-amine is sourced from PubChem (CID 56926046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).