C30H44O4 — CID 56926225
(1R,2S,5S,10S,14S,15R,16R,18R,21R)-1,2,8,8,15,20,20-heptamethyl-19-oxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-5-carboxylic acid (PubChem CID 56926225) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (1R,2S,5S,10S,14S,15R,16R,18R,21R)-1,2,8,8,15,20,20-heptamethyl-19-oxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-5-carboxylic acid.
| Compound Name | (1R,2S,5S,10S,14S,15R,16R,18R,21R)-1,2,8,8,15,20,20-heptamethyl-19-oxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 56926225 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (1R,2S,5S,10S,14S,15R,16R,18R,21R)-1,2,8,8,15,20,20-heptamethyl-19-oxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-5-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)[C@H]6O[C@H]6C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C30H44O4/c1-25(2)12-14-30(24(32)33)15-13-27(5)17(18(30)16-25)8-9-20-28(27,6)11-10-19-26(3,4)22(31)21-23(34-21)29(19,20)7/h8,18-21,23H,9-16H2,1-7H3,(H,32,33)/t18-,19-,20-,21-,23-,27+,28+,29-,30-/m0/s1 |
| InChIKey | CZPUPXTWEPZIGN-KPIGWCSYSA-N |
| XLogP | 6.43 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|