C15H24O4 — CID 56926296
2-[(2S,4aR,5S,8aS)-4a,5,8a-trimethyl-1-oxo-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]-2-hydroxyacetic acid (PubChem CID 56926296) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-[(2S,4aR,5S,8aS)-4a,5,8a-trimethyl-1-oxo-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]-2-hydroxyacetic acid.
| Compound Name | 2-[(2S,4aR,5S,8aS)-4a,5,8a-trimethyl-1-oxo-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 56926296 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-[(2S,4aR,5S,8aS)-4a,5,8a-trimethyl-1-oxo-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]-2-hydroxyacetic acid |
| SMILES | C[C@H]1CCC[C@]2(C)C(=O)[C@H](C(O)C(=O)O)CC[C@]12C |
| InChI | InChI=1S/C15H24O4/c1-9-5-4-7-15(3)12(17)10(11(16)13(18)19)6-8-14(9,15)2/h9-11,16H,4-8H2,1-3H3,(H,18,19)/t9-,10-,11?,14+,15+/m0/s1 |
| InChIKey | IAEQYZWSXCQPFB-CMZIHQLMSA-N |
| XLogP | 2.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |