C17H28O3 — CID 56926297
(4aR,5S,8aS)-2-(2,2-dimethoxyethyl)-4a,5,8a-trimethyl-5,6,7,8-tetrahydro-4H-naphthalen-1-one (PubChem CID 56926297) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (4aR,5S,8aS)-2-(2,2-dimethoxyethyl)-4a,5,8a-trimethyl-5,6,7,8-tetrahydro-4H-naphthalen-1-one.
| Compound Name | (4aR,5S,8aS)-2-(2,2-dimethoxyethyl)-4a,5,8a-trimethyl-5,6,7,8-tetrahydro-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 56926297 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (4aR,5S,8aS)-2-(2,2-dimethoxyethyl)-4a,5,8a-trimethyl-5,6,7,8-tetrahydro-4H-naphthalen-1-one |
| SMILES | COC(CC1=CC[C@]2(C)[C@@H](C)CCC[C@]2(C)C1=O)OC |
| InChI | InChI=1S/C17H28O3/c1-12-7-6-9-17(3)15(18)13(8-10-16(12,17)2)11-14(19-4)20-5/h8,12,14H,6-7,9-11H2,1-5H3/t12-,16+,17+/m0/s1 |
| InChIKey | IDSAEMFQCPUIHH-JCURWCKSSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|