C18H24F10N2O4 — CID 56926300
2,2,3,3,3-pentafluoropropyl N-[[1,3,3-trimethyl-5-(2,2,3,3,3-pentafluoropropoxycarbonylamino)cyclohexyl]methyl]carbamate (PubChem CID 56926300) has the molecular formula C18H24F10N2O4 and a molecular weight of 522.38 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl N-[[1,3,3-trimethyl-5-(2,2,3,3,3-pentafluoropropoxycarbonylamino)cyclohexyl]methyl]carbamate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl N-[[1,3,3-trimethyl-5-(2,2,3,3,3-pentafluoropropoxycarbonylamino)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 56926300 |
| Molecular Formula | C18H24F10N2O4 |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl N-[[1,3,3-trimethyl-5-(2,2,3,3,3-pentafluoropropoxycarbonylamino)cyclohexyl]methyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)OCC(F)(F)C(F)(F)F)CC(C)(CNC(=O)OCC(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H24F10N2O4/c1-13(2)4-10(30-12(32)34-9-16(21,22)18(26,27)28)5-14(3,6-13)7-29-11(31)33-8-15(19,20)17(23,24)25/h10H,4-9H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | LIRGMAAVRHJRSC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|