C26H44N7O10P — CID 56926616
2,2-dimethylpropyl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[[2-(2,2-dimethylpropoxy)-2-oxoethyl]amino]phosphoryl]amino]acetate (PubChem CID 56926616) has the molecular formula C26H44N7O10P and a molecular weight of 645.65 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[[2-(2,2-dimethylpropoxy)-2-oxoethyl]amino]phosphoryl]amino]acetate.
| Compound Name | 2,2-dimethylpropyl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[[2-(2,2-dimethylpropoxy)-2-oxoethyl]amino]phosphoryl]amino]acetate |
|---|---|
| PubChem CID | 56926616 |
| Molecular Formula | C26H44N7O10P |
| Molecular Weight | 645.65 g/mol |
| Exact Mass | 645.29 |
| IUPAC Name | 2,2-dimethylpropyl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[[2-(2,2-dimethylpropoxy)-2-oxoethyl]amino]phosphoryl]amino]acetate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(NCC(=O)OCC(C)(C)C)NCC(=O)OCC(C)(C)C)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C26H44N7O10P/c1-24(2,3)12-40-16(34)9-29-44(38,30-10-17(35)41-13-25(4,5)6)42-11-15-19(36)26(7,37)22(43-15)33-14-28-18-20(33)31-23(27)32-21(18)39-8/h14-15,19,22,36-37H,9-13H2,1-8H3,(H2,27,31,32)(H2,29,30,38)/t15-,19-,22-,26-/m1/s1 |
| InChIKey | VNNWEVSPWPTMIR-LEUJHBLLSA-N |
| XLogP | 0.91 |
| TPSA | 231.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.65 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|