C15H22O8 — CID 56926704
[(2R,3R,4aR,8R,8aS)-8-hydroxy-2,3-dimethoxy-2,3-dimethyl-5-oxo-8,8a-dihydro-4aH-1,4-benzodioxin-7-yl]methyl acetate (PubChem CID 56926704) has the molecular formula C15H22O8 and a molecular weight of 330.33 g/mol. Its IUPAC name is [(2R,3R,4aR,8R,8aS)-8-hydroxy-2,3-dimethoxy-2,3-dimethyl-5-oxo-8,8a-dihydro-4aH-1,4-benzodioxin-7-yl]methyl acetate.
| Compound Name | [(2R,3R,4aR,8R,8aS)-8-hydroxy-2,3-dimethoxy-2,3-dimethyl-5-oxo-8,8a-dihydro-4aH-1,4-benzodioxin-7-yl]methyl acetate |
|---|---|
| PubChem CID | 56926704 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [(2R,3R,4aR,8R,8aS)-8-hydroxy-2,3-dimethoxy-2,3-dimethyl-5-oxo-8,8a-dihydro-4aH-1,4-benzodioxin-7-yl]methyl acetate |
| SMILES | CO[C@]1(C)O[C@H]2[C@H](O)C(COC(C)=O)=CC(=O)[C@@H]2O[C@@]1(C)OC |
| InChI | InChI=1S/C15H22O8/c1-8(16)21-7-9-6-10(17)12-13(11(9)18)23-15(3,20-5)14(2,19-4)22-12/h6,11-13,18H,7H2,1-5H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | NZJAYJULJWPIIC-GZBLMMOJSA-N |
| XLogP | -0.07 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |