C27H44N4O3 — CID 56926782
(3R,6R,9S)-3-benzyl-9-[(2S)-butan-2-yl]-6,7-dimethyl-1,4,7,10-tetrazacyclooctadecane-2,5,8-trione (PubChem CID 56926782) has the molecular formula C27H44N4O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is (3R,6R,9S)-3-benzyl-9-[(2S)-butan-2-yl]-6,7-dimethyl-1,4,7,10-tetrazacyclooctadecane-2,5,8-trione.
| Compound Name | (3R,6R,9S)-3-benzyl-9-[(2S)-butan-2-yl]-6,7-dimethyl-1,4,7,10-tetrazacyclooctadecane-2,5,8-trione |
|---|---|
| PubChem CID | 56926782 |
| Molecular Formula | C27H44N4O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | (3R,6R,9S)-3-benzyl-9-[(2S)-butan-2-yl]-6,7-dimethyl-1,4,7,10-tetrazacyclooctadecane-2,5,8-trione |
| SMILES | CC[C@H](C)[C@@H]1NCCCCCCCCNC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C27H44N4O3/c1-5-20(2)24-27(34)31(4)21(3)25(32)30-23(19-22-15-11-10-12-16-22)26(33)29-18-14-9-7-6-8-13-17-28-24/h10-12,15-16,20-21,23-24,28H,5-9,13-14,17-19H2,1-4H3,(H,29,33)(H,30,32)/t20-,21+,23+,24-/m0/s1 |
| InChIKey | RDONEVHLXOBAHH-SCDRESIJSA-N |
| XLogP | 3.04 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |