About N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide
N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide (PubChem CID 56926901) has the molecular formula C20H21NO2
and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide.
Molecular Properties
| Compound Name | N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide |
| PubChem CID | 56926901 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide |
| SMILES | CCC(=O)NC1=Cc2c(OC)cccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C20H21NO2/c1-3-20(22)21-15-12-17(14-8-5-4-6-9-14)16-10-7-11-19(23-2)18(16)13-15/h4-11,13,17H,3,12H2,1-2H3,(H,21,22) |
| InChIKey | AWMUWKVJCZJWNQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide?
The IUPAC name of N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide (CID 56926901) is N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide.
What is the SMILES notation for N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide?
The canonical SMILES for N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide is CCC(=O)NC1=Cc2c(OC)cccc2C(c2ccccc2)C1.
What is the InChIKey of N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide?
The InChIKey is AWMUWKVJCZJWNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO2/c1-3-20(22)21-15-12-17(14-8-5-4-6-9-14)16-10-7-11-19(23-2)18(16)13-15/h4-11,13,17H,3,12H2,1-2H3,(H,21,22).
What are the key properties of N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide?
N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide has a molecular weight of 307.39 g/mol, XLogP of 4.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-methoxy-4-phenyl-3,4-dihydronaphthalen-2-yl)propanamide is sourced from PubChem (CID 56926901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).