C14H21NO — CID 56927085
(3R,3aR,5R,8aS)-8a-hydroxy-3,5,8-trimethyl-1,2,3,3a,4,6-hexahydroazulene-5-carbonitrile (PubChem CID 56927085) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (3R,3aR,5R,8aS)-8a-hydroxy-3,5,8-trimethyl-1,2,3,3a,4,6-hexahydroazulene-5-carbonitrile.
| Compound Name | (3R,3aR,5R,8aS)-8a-hydroxy-3,5,8-trimethyl-1,2,3,3a,4,6-hexahydroazulene-5-carbonitrile |
|---|---|
| PubChem CID | 56927085 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (3R,3aR,5R,8aS)-8a-hydroxy-3,5,8-trimethyl-1,2,3,3a,4,6-hexahydroazulene-5-carbonitrile |
| SMILES | CC1=CC[C@@](C)(C#N)C[C@@H]2[C@H](C)CC[C@@]12O |
| InChI | InChI=1S/C14H21NO/c1-10-4-7-14(16)11(2)5-6-13(3,9-15)8-12(10)14/h5,10,12,16H,4,6-8H2,1-3H3/t10-,12-,13-,14-/m1/s1 |
| InChIKey | YJDYBBSACFMWLZ-FMKGYKFTSA-N |
| XLogP | 3.03 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|