C15H26O5 — CID 56927436
(1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-2-pentyl-3,11-dioxabicyclo[6.2.1]undecan-4-one (PubChem CID 56927436) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-2-pentyl-3,11-dioxabicyclo[6.2.1]undecan-4-one.
| Compound Name | (1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-2-pentyl-3,11-dioxabicyclo[6.2.1]undecan-4-one |
|---|---|
| PubChem CID | 56927436 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-2-pentyl-3,11-dioxabicyclo[6.2.1]undecan-4-one |
| SMILES | CCCCC[C@H]1OC(=O)[C@H](C)[C@H](O)[C@@H](O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C15H26O5/c1-3-4-5-6-10-11-7-8-12(19-11)14(17)13(16)9(2)15(18)20-10/h9-14,16-17H,3-8H2,1-2H3/t9-,10-,11+,12-,13+,14+/m1/s1 |
| InChIKey | XVTCTFSSMXYPHW-PRFQISJJSA-N |
| XLogP | 1.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|