C17H28O7 — CID 56927437
5-[(1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-4-oxo-3,11-dioxabicyclo[6.2.1]undecan-2-yl]pentyl acetate (PubChem CID 56927437) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is 5-[(1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-4-oxo-3,11-dioxabicyclo[6.2.1]undecan-2-yl]pentyl acetate.
| Compound Name | 5-[(1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-4-oxo-3,11-dioxabicyclo[6.2.1]undecan-2-yl]pentyl acetate |
|---|---|
| PubChem CID | 56927437 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5-[(1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-4-oxo-3,11-dioxabicyclo[6.2.1]undecan-2-yl]pentyl acetate |
| SMILES | CC(=O)OCCCCC[C@H]1OC(=O)[C@H](C)[C@H](O)[C@@H](O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C17H28O7/c1-10-15(19)16(20)14-8-7-13(23-14)12(24-17(10)21)6-4-3-5-9-22-11(2)18/h10,12-16,19-20H,3-9H2,1-2H3/t10-,12-,13+,14-,15+,16+/m1/s1 |
| InChIKey | AXMYBKVKZPWGTH-BAGFCZJQSA-N |
| XLogP | 0.94 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|