C9H13NO3 — CID 56927459
(1S,3aR,4R,7S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-4,7-epoxyisoindole-1-carboxylic acid (PubChem CID 56927459) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (1S,3aR,4R,7S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-4,7-epoxyisoindole-1-carboxylic acid.
| Compound Name | (1S,3aR,4R,7S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-4,7-epoxyisoindole-1-carboxylic acid |
|---|---|
| PubChem CID | 56927459 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (1S,3aR,4R,7S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-4,7-epoxyisoindole-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1NC[C@H]2[C@@H]1[C@@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C9H13NO3/c11-9(12)8-7-4(3-10-8)5-1-2-6(7)13-5/h4-8,10H,1-3H2,(H,11,12)/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | UTZOISYBEKQEKP-CBQIKETKSA-N |
| XLogP | -0.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |