About 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid
2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid (PubChem CID 56928041) has the molecular formula C21H14Cl3NO3S
and a molecular weight of 466.77 g/mol. Its IUPAC name is 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid |
| PubChem CID | 56928041 |
| Molecular Formula | C21H14Cl3NO3S |
| Molecular Weight | 466.77 g/mol |
| Exact Mass | 464.98 |
| IUPAC Name | 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NCc1c(Cl)cccc1Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H14Cl3NO3S/c22-12-8-9-19(17(24)10-12)29-18-7-3-6-16(23)15(18)11-25-20(26)13-4-1-2-5-14(13)21(27)28/h1-10H,11H2,(H,25,26)(H,27,28) |
| InChIKey | HLWGMGIORMMWMJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.77 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid?
The IUPAC name of 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid (CID 56928041) is 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid.
What is the SMILES notation for 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid?
The canonical SMILES for 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid is O=C(O)c1ccccc1C(=O)NCc1c(Cl)cccc1Sc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid?
The InChIKey is HLWGMGIORMMWMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14Cl3NO3S/c22-12-8-9-19(17(24)10-12)29-18-7-3-6-16(23)15(18)11-25-20(26)13-4-1-2-5-14(13)21(27)28/h1-10H,11H2,(H,25,26)(H,27,28).
What are the key properties of 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid?
2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid has a molecular weight of 466.77 g/mol, XLogP of 6.43, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-chloro-6-(2,4-dichlorophenyl)sulfanylphenyl]methylcarbamoyl]benzoic acid is sourced from PubChem (CID 56928041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).